C18H26O2 — CID 79900340
1-(4-methylphenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanol (PubChem CID 79900340) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-(4-methylphenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanol.
| Compound Name | 1-(4-methylphenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanol |
|---|---|
| PubChem CID | 79900340 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-(4-methylphenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanol |
| SMILES | Cc1ccc(C(C)(O)C2CCOC3(CCCC3)C2)cc1 |
| InChI | InChI=1S/C18H26O2/c1-14-5-7-15(8-6-14)17(2,19)16-9-12-20-18(13-16)10-3-4-11-18/h5-8,16,19H,3-4,9-13H2,1-2H3 |
| InChIKey | AMPBLNUQFBAYEY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |