C16H19Cl2FO2 — CID 79902299
1-(2,4-dichloro-5-fluorophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol (PubChem CID 79902299) has the molecular formula C16H19Cl2FO2 and a molecular weight of 333.23 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol |
|---|---|
| PubChem CID | 79902299 |
| Molecular Formula | C16H19Cl2FO2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol |
| SMILES | CC(O)(c1cc(F)c(Cl)cc1Cl)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C16H19Cl2FO2/c1-15(20,11-7-14(19)13(18)8-12(11)17)10-3-6-21-16(9-10)4-2-5-16/h7-8,10,20H,2-6,9H2,1H3 |
| InChIKey | NQRNQOSCWUMXMU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|