C17H23BrO3 — CID 79899154
1-(2-bromophenyl)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanol (PubChem CID 79899154) has the molecular formula C17H23BrO3 and a molecular weight of 355.27 g/mol. Its IUPAC name is 1-(2-bromophenyl)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanol.
| Compound Name | 1-(2-bromophenyl)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanol |
|---|---|
| PubChem CID | 79899154 |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-(2-bromophenyl)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanol |
| SMILES | CC(O)(c1ccccc1Br)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C17H23BrO3/c1-16(19,14-4-2-3-5-15(14)18)13-6-9-21-17(12-13)7-10-20-11-8-17/h2-5,13,19H,6-12H2,1H3 |
| InChIKey | ZXUZDALEHZODKX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |