C14H26O3 — CID 79899451
2-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methylbutan-2-ol (PubChem CID 79899451) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methylbutan-2-ol.
| Compound Name | 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 79899451 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methylbutan-2-ol |
| SMILES | CC(C)C(C)(O)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C14H26O3/c1-11(2)13(3,15)12-4-7-17-14(10-12)5-8-16-9-6-14/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | GOAQVODTLQOIMO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |