C17H32O3 — CID 114865417
4-(2,6-dioxaspiro[4.5]decan-9-yl)-2,6-dimethylheptan-4-ol (PubChem CID 114865417) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 4-(2,6-dioxaspiro[4.5]decan-9-yl)-2,6-dimethylheptan-4-ol.
| Compound Name | 4-(2,6-dioxaspiro[4.5]decan-9-yl)-2,6-dimethylheptan-4-ol |
|---|---|
| PubChem CID | 114865417 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 4-(2,6-dioxaspiro[4.5]decan-9-yl)-2,6-dimethylheptan-4-ol |
| SMILES | CC(C)CC(O)(CC(C)C)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C17H32O3/c1-13(2)9-17(18,10-14(3)4)15-5-7-20-16(11-15)6-8-19-12-16/h13-15,18H,5-12H2,1-4H3 |
| InChIKey | WCFIBJOVVHURMD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |