C11H20FNO2 — CID 112565121
2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoropropan-1-amine (PubChem CID 112565121) has the molecular formula C11H20FNO2 and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoropropan-1-amine.
| Compound Name | 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoropropan-1-amine |
|---|---|
| PubChem CID | 112565121 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoropropan-1-amine |
| SMILES | CC(F)(CN)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C11H20FNO2/c1-10(12,7-13)9-2-4-15-11(6-9)3-5-14-8-11/h9H,2-8,13H2,1H3 |
| InChIKey | UUIMUWJAEZUYDQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |