C17H32O2 — CID 114865476
2,6-dimethyl-4-(5-oxaspiro[3.5]nonan-8-yl)heptan-4-ol (PubChem CID 114865476) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2,6-dimethyl-4-(5-oxaspiro[3.5]nonan-8-yl)heptan-4-ol.
| Compound Name | 2,6-dimethyl-4-(5-oxaspiro[3.5]nonan-8-yl)heptan-4-ol |
|---|---|
| PubChem CID | 114865476 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 2,6-dimethyl-4-(5-oxaspiro[3.5]nonan-8-yl)heptan-4-ol |
| SMILES | CC(C)CC(O)(CC(C)C)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C17H32O2/c1-13(2)10-17(18,11-14(3)4)15-6-9-19-16(12-15)7-5-8-16/h13-15,18H,5-12H2,1-4H3 |
| InChIKey | RYOGOXRWPNJJGZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |