C17H24FNO — CID 79912639
1-(2-fluorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine (PubChem CID 79912639) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine.
| Compound Name | 1-(2-fluorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine |
|---|---|
| PubChem CID | 79912639 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-(2-fluorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine |
| SMILES | CC(N)(c1ccccc1F)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H24FNO/c1-16(19,14-6-2-3-7-15(14)18)13-8-11-20-17(12-13)9-4-5-10-17/h2-3,6-7,13H,4-5,8-12,19H2,1H3 |
| InChIKey | HSWDKIJPBPRZIG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |