C12H16F3N3O2S — CID 79900413
5-amino-3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2-methylbenzenesulfonamide (PubChem CID 79900413) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 5-amino-3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79900413 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-amino-3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(N(CC(F)(F)F)C2CC2)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H16F3N3O2S/c1-7-10(4-8(16)5-11(7)21(17,19)20)18(9-2-3-9)6-12(13,14)15/h4-5,9H,2-3,6,16H2,1H3,(H2,17,19,20) |
| InChIKey | RDSPRPROLVKLDJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|