1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid

C16H27NO4 — CID 79901428

IUPAC1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid
SMILESO=C(O)C1CCCCCN1C1CCOC2(CCOCC2)C1
InChIInChI=1S/C16H27NO4/c18-15(19)14-4-2-1-3-8-17(14)13-5-9-21-16(12-13)6-10-20-11-7-16/h13-14H,1-12H2,(H,18,19)
InChIKeyVIVFELREVSLVHA-UHFFFAOYSA-N
MW297.40 g/mol
LogP2.04
Rot. Bonds2

About 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid

1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid (PubChem CID 79901428) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid.

Molecular Properties

Compound Name1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid
PubChem CID79901428
Molecular FormulaC16H27NO4
Molecular Weight297.40 g/mol
Exact Mass297.19
IUPAC Name1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid
SMILESO=C(O)C1CCCCCN1C1CCOC2(CCOCC2)C1
InChIInChI=1S/C16H27NO4/c18-15(19)14-4-2-1-3-8-17(14)13-5-9-21-16(12-13)6-10-20-11-7-16/h13-14H,1-12H2,(H,18,19)
InChIKeyVIVFELREVSLVHA-UHFFFAOYSA-N
XLogP2.04
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.40
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid?
The IUPAC name of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid (CID 79901428) is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid.
What is the SMILES notation for 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid?
The canonical SMILES for 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid is O=C(O)C1CCCCCN1C1CCOC2(CCOCC2)C1.
What is the InChIKey of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid?
The InChIKey is VIVFELREVSLVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO4/c18-15(19)14-4-2-1-3-8-17(14)13-5-9-21-16(12-13)6-10-20-11-7-16/h13-14H,1-12H2,(H,18,19).
What are the key properties of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid?
1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid has a molecular weight of 297.40 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid is sourced from PubChem (CID 79901428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).