C16H27NO4 — CID 79901428
1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid (PubChem CID 79901428) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid |
|---|---|
| PubChem CID | 79901428 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azepane-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCCN1C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H27NO4/c18-15(19)14-4-2-1-3-8-17(14)13-5-9-21-16(12-13)6-10-20-11-7-16/h13-14H,1-12H2,(H,18,19) |
| InChIKey | VIVFELREVSLVHA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |