C15H26N2O2S — CID 79905951
1-(1,9-dioxaspiro[5.5]undecan-4-yl)piperidine-2-carbothioamide (PubChem CID 79905951) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)piperidine-2-carbothioamide.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)piperidine-2-carbothioamide |
|---|---|
| PubChem CID | 79905951 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)piperidine-2-carbothioamide |
| SMILES | NC(=S)C1CCCCN1C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H26N2O2S/c16-14(20)13-3-1-2-7-17(13)12-4-8-19-15(11-12)5-9-18-10-6-15/h12-13H,1-11H2,(H2,16,20) |
| InChIKey | LEXNKXVWDXSJIE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|