C15H29NO3 — CID 79904099
2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2-ethylbutan-1-ol (PubChem CID 79904099) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2-ethylbutan-1-ol.
| Compound Name | 2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 79904099 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)NC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H29NO3/c1-3-14(4-2,12-17)16-13-5-8-19-15(11-13)6-9-18-10-7-15/h13,16-17H,3-12H2,1-2H3 |
| InChIKey | IINSAZYSGQFUJX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |