C13H13BrN2O2S2 — CID 79904670
5-amino-3-(2-bromophenyl)sulfanyl-2-methylbenzenesulfonamide (PubChem CID 79904670) has the molecular formula C13H13BrN2O2S2 and a molecular weight of 373.30 g/mol. Its IUPAC name is 5-amino-3-(2-bromophenyl)sulfanyl-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-(2-bromophenyl)sulfanyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79904670 |
| Molecular Formula | C13H13BrN2O2S2 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 5-amino-3-(2-bromophenyl)sulfanyl-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Sc2ccccc2Br)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H13BrN2O2S2/c1-8-12(19-11-5-3-2-4-10(11)14)6-9(15)7-13(8)20(16,17)18/h2-7H,15H2,1H3,(H2,16,17,18) |
| InChIKey | SETPYUNWZIAOQA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|