C16H20O4 — CID 79906115
3-methoxy-4-(5-oxaspiro[3.5]nonan-8-yloxy)benzaldehyde (PubChem CID 79906115) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-methoxy-4-(5-oxaspiro[3.5]nonan-8-yloxy)benzaldehyde.
| Compound Name | 3-methoxy-4-(5-oxaspiro[3.5]nonan-8-yloxy)benzaldehyde |
|---|---|
| PubChem CID | 79906115 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-methoxy-4-(5-oxaspiro[3.5]nonan-8-yloxy)benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OC1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C16H20O4/c1-18-15-9-12(11-17)3-4-14(15)20-13-5-8-19-16(10-13)6-2-7-16/h3-4,9,11,13H,2,5-8,10H2,1H3 |
| InChIKey | KJZRBNMCGZASTI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|