C15H24F3NOS — CID 79908105
1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 79908105) has the molecular formula C15H24F3NOS and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79908105 |
| Molecular Formula | C15H24F3NOS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | NC1(C2CCOC3(CCSC3)C2)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H24F3NOS/c16-15(17,18)11-1-4-14(19,5-2-11)12-3-7-20-13(9-12)6-8-21-10-13/h11-12H,1-10,19H2 |
| InChIKey | XRHQVLQQCDFRIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |