C15H23F3O2S — CID 79906886
1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 79906886) has the molecular formula C15H23F3O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79906886 |
| Molecular Formula | C15H23F3O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(C2CCOC3(CCSC3)C2)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H23F3O2S/c16-15(17,18)11-1-4-14(19,5-2-11)12-3-7-20-13(9-12)6-8-21-10-13/h11-12,19H,1-10H2 |
| InChIKey | KSMQCJCKUORZRP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |