C11H14F4O2S — CID 114032513
2,2,3,3-tetrafluoro-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-one (PubChem CID 114032513) has the molecular formula C11H14F4O2S and a molecular weight of 286.29 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-one |
|---|---|
| PubChem CID | 114032513 |
| Molecular Formula | C11H14F4O2S |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)propan-1-one |
| SMILES | O=C(C1CCOC2(CCSC2)C1)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H14F4O2S/c12-9(13)11(14,15)8(16)7-1-3-17-10(5-7)2-4-18-6-10/h7,9H,1-6H2 |
| InChIKey | RWFCJQZMRIUKFW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|