C13H19ClN2O3S2 — CID 79908468
2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)imidazole-4-sulfonyl chloride (PubChem CID 79908468) has the molecular formula C13H19ClN2O3S2 and a molecular weight of 350.89 g/mol. Its IUPAC name is 2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)imidazole-4-sulfonyl chloride.
| Compound Name | 2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)imidazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 79908468 |
| Molecular Formula | C13H19ClN2O3S2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)imidazole-4-sulfonyl chloride |
| SMILES | Cc1nc(S(=O)(=O)Cl)cn1C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C13H19ClN2O3S2/c1-10-15-12(21(14,17)18)9-16(10)11-2-5-19-13(8-11)3-6-20-7-4-13/h9,11H,2-8H2,1H3 |
| InChIKey | SFCFMBOYFWGQKK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |