C11H15ClN2O3S2 — CID 79911466
1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pyrazole-4-sulfonyl chloride (PubChem CID 79911466) has the molecular formula C11H15ClN2O3S2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pyrazole-4-sulfonyl chloride.
| Compound Name | 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 79911466 |
| Molecular Formula | C11H15ClN2O3S2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pyrazole-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cnn(C2CCOC3(CCSC3)C2)c1 |
| InChI | InChI=1S/C11H15ClN2O3S2/c12-19(15,16)10-6-13-14(7-10)9-1-3-17-11(5-9)2-4-18-8-11/h6-7,9H,1-5,8H2 |
| InChIKey | OAAXJXCTBHJMFN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |