C20H26N2 — CID 79909917
1-benzyl-3,3-diethyl-4,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 79909917) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-benzyl-3,3-diethyl-4,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 1-benzyl-3,3-diethyl-4,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 79909917 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-benzyl-3,3-diethyl-4,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CCC1(CC)CN(Cc2ccccc2)c2ccccc2CN1 |
| InChI | InChI=1S/C20H26N2/c1-3-20(4-2)16-22(15-17-10-6-5-7-11-17)19-13-9-8-12-18(19)14-21-20/h5-13,21H,3-4,14-16H2,1-2H3 |
| InChIKey | OYHDLHSAKQFTDX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |