C17H32N2O2 — CID 79912796
4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N,2,2,5,5-pentamethyloxolan-3-amine (PubChem CID 79912796) has the molecular formula C17H32N2O2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N,2,2,5,5-pentamethyloxolan-3-amine.
| Compound Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N,2,2,5,5-pentamethyloxolan-3-amine |
|---|---|
| PubChem CID | 79912796 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N,2,2,5,5-pentamethyloxolan-3-amine |
| SMILES | CNC1C(CN2CCOC3CCCC32)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C17H32N2O2/c1-16(2)12(15(18-5)17(3,4)21-16)11-19-9-10-20-14-8-6-7-13(14)19/h12-15,18H,6-11H2,1-5H3 |
| InChIKey | JSPSATRMSNDIKD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |