C16H33NO4 — CID 79914921
4-[[2-methoxyethyl(3-methoxypropyl)amino]methyl]-2,2,5,5-tetramethyloxolan-3-ol (PubChem CID 79914921) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is 4-[[2-methoxyethyl(3-methoxypropyl)amino]methyl]-2,2,5,5-tetramethyloxolan-3-ol.
| Compound Name | 4-[[2-methoxyethyl(3-methoxypropyl)amino]methyl]-2,2,5,5-tetramethyloxolan-3-ol |
|---|---|
| PubChem CID | 79914921 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 4-[[2-methoxyethyl(3-methoxypropyl)amino]methyl]-2,2,5,5-tetramethyloxolan-3-ol |
| SMILES | COCCCN(CCOC)CC1C(O)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H33NO4/c1-15(2)13(14(18)16(3,4)21-15)12-17(9-11-20-6)8-7-10-19-5/h13-14,18H,7-12H2,1-6H3 |
| InChIKey | NIPNCZYCSUQXFW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|