C14H23NOS — CID 79917629
2,2,5,5-tetramethyl-N-(1-thiophen-2-ylethyl)oxolan-3-amine (PubChem CID 79917629) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-(1-thiophen-2-ylethyl)oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-(1-thiophen-2-ylethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 79917629 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-(1-thiophen-2-ylethyl)oxolan-3-amine |
| SMILES | CC(NC1CC(C)(C)OC1(C)C)c1cccs1 |
| InChI | InChI=1S/C14H23NOS/c1-10(11-7-6-8-17-11)15-12-9-13(2,3)16-14(12,4)5/h6-8,10,12,15H,9H2,1-5H3 |
| InChIKey | SRVXZTGMHQQXOD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |