C14H22N4O2S — CID 79919032
3-amino-5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzenesulfonamide (PubChem CID 79919032) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-amino-5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 79919032 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-amino-5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzenesulfonamide |
| SMILES | Nc1cc(N2CCN3CCCCC3C2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H22N4O2S/c15-11-7-13(9-14(8-11)21(16,19)20)18-6-5-17-4-2-1-3-12(17)10-18/h7-9,12H,1-6,10,15H2,(H2,16,19,20) |
| InChIKey | DYRDCVGIWYSDHO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|