C15H25N3O2 — CID 79920296
1-[1-(2,6-dioxaspiro[4.5]decan-9-yl)pyrazol-4-yl]butan-2-amine (PubChem CID 79920296) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-[1-(2,6-dioxaspiro[4.5]decan-9-yl)pyrazol-4-yl]butan-2-amine.
| Compound Name | 1-[1-(2,6-dioxaspiro[4.5]decan-9-yl)pyrazol-4-yl]butan-2-amine |
|---|---|
| PubChem CID | 79920296 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-[1-(2,6-dioxaspiro[4.5]decan-9-yl)pyrazol-4-yl]butan-2-amine |
| SMILES | CCC(N)Cc1cnn(C2CCOC3(CCOC3)C2)c1 |
| InChI | InChI=1S/C15H25N3O2/c1-2-13(16)7-12-9-17-18(10-12)14-3-5-20-15(8-14)4-6-19-11-15/h9-10,13-14H,2-8,11,16H2,1H3 |
| InChIKey | QMBQJZMTFLNXIE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |