C11H17F3O2 — CID 79921915
2,2,2-trifluoro-1-(6-oxaspiro[4.5]decan-9-yl)ethanol (PubChem CID 79921915) has the molecular formula C11H17F3O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(6-oxaspiro[4.5]decan-9-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(6-oxaspiro[4.5]decan-9-yl)ethanol |
|---|---|
| PubChem CID | 79921915 |
| Molecular Formula | C11H17F3O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2,2,2-trifluoro-1-(6-oxaspiro[4.5]decan-9-yl)ethanol |
| SMILES | OC(C1CCOC2(CCCC2)C1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O2/c12-11(13,14)9(15)8-3-6-16-10(7-8)4-1-2-5-10/h8-9,15H,1-7H2 |
| InChIKey | IXLNDEZBZTVSBW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |