C12H19F3O2 — CID 79921916
2,2,2-trifluoro-1-(1-oxaspiro[5.5]undecan-4-yl)ethanol (PubChem CID 79921916) has the molecular formula C12H19F3O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-oxaspiro[5.5]undecan-4-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(1-oxaspiro[5.5]undecan-4-yl)ethanol |
|---|---|
| PubChem CID | 79921916 |
| Molecular Formula | C12H19F3O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-oxaspiro[5.5]undecan-4-yl)ethanol |
| SMILES | OC(C1CCOC2(CCCCC2)C1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3O2/c13-12(14,15)10(16)9-4-7-17-11(8-9)5-2-1-3-6-11/h9-10,16H,1-8H2 |
| InChIKey | YMABBFVVCKTDMH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |