C13H25N3O2S — CID 79924714
3-methyl-2-pyrrolidin-3-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 79924714) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 3-methyl-2-pyrrolidin-3-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 3-methyl-2-pyrrolidin-3-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79924714 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-methyl-2-pyrrolidin-3-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CC1CN2CCCCC2CN1S(=O)(=O)C1CCNC1 |
| InChI | InChI=1S/C13H25N3O2S/c1-11-9-15-7-3-2-4-12(15)10-16(11)19(17,18)13-5-6-14-8-13/h11-14H,2-10H2,1H3 |
| InChIKey | JAQBZJZEZMCCTA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |