C12H23N3O2S2 — CID 79931312
2-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)sulfonyl]propanethioamide (PubChem CID 79931312) has the molecular formula C12H23N3O2S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)sulfonyl]propanethioamide.
| Compound Name | 2-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)sulfonyl]propanethioamide |
|---|---|
| PubChem CID | 79931312 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)sulfonyl]propanethioamide |
| SMILES | CC1CN2CCCCC2CN1S(=O)(=O)C(C)C(N)=S |
| InChI | InChI=1S/C12H23N3O2S2/c1-9-7-14-6-4-3-5-11(14)8-15(9)19(16,17)10(2)12(13)18/h9-11H,3-8H2,1-2H3,(H2,13,18) |
| InChIKey | JNHIAJCQZWAGLD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|