C14H20N2O4S — CID 79926041
2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 79926041) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 79926041 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC(C)C1C(=O)N2CCCC2C(=O)N1C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20N2O4S/c1-9(2)12-14(18)15-6-3-4-11(15)13(17)16(12)10-5-7-21(19,20)8-10/h5,7,9-12H,3-4,6,8H2,1-2H3 |
| InChIKey | LBEXPORUJCLBFJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |