C13H18N2O4S — CID 79944658
2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-ethyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 79944658) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-ethyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-ethyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 79944658 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-ethyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CCC1C(=O)N2CCCC2C(=O)N1C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O4S/c1-2-10-12(16)14-6-3-4-11(14)13(17)15(10)9-5-7-20(18,19)8-9/h5,7,9-11H,2-4,6,8H2,1H3 |
| InChIKey | XJZYRXKSYMAKGL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |