C16H20F2N2O — CID 79929510
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2,4-difluorophenyl)propan-1-one (PubChem CID 79929510) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2,4-difluorophenyl)propan-1-one.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 79929510 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2,4-difluorophenyl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(F)cc1F)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C16H20F2N2O/c1-11(16(21)14-5-4-12(17)9-15(14)18)20-8-7-19-6-2-3-13(19)10-20/h4-5,9,11,13H,2-3,6-8,10H2,1H3 |
| InChIKey | ZLYCXFIKPVPOLJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |