C17H23ClFN3O — CID 166185461
N-(2-chloro-4-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanamide (PubChem CID 166185461) has the molecular formula C17H23ClFN3O and a molecular weight of 339.84 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 166185461 |
| Molecular Formula | C17H23ClFN3O |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(F)cc1Cl)N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C17H23ClFN3O/c1-12(17(23)20-16-5-4-13(19)10-15(16)18)22-9-6-14(11-22)21-7-2-3-8-21/h4-5,10,12,14H,2-3,6-9,11H2,1H3,(H,20,23) |
| InChIKey | AFBOFFWNNVSIDY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |