C15H24BrN3S — CID 79930781
2-(5-bromothiophen-2-yl)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethanamine (PubChem CID 79930781) has the molecular formula C15H24BrN3S and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 79930781 |
| Molecular Formula | C15H24BrN3S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethanamine |
| SMILES | CC1CN2CCCCC2CN1C(CN)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H24BrN3S/c1-11-9-18-7-3-2-4-12(18)10-19(11)13(8-17)14-5-6-15(16)20-14/h5-6,11-13H,2-4,7-10,17H2,1H3 |
| InChIKey | LEYRVPPFKGYIIH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |