C16H26BrN3S — CID 61215775
2-(5-bromothiophen-2-yl)-2-(4-piperidin-1-ylpiperidin-1-yl)ethanamine (PubChem CID 61215775) has the molecular formula C16H26BrN3S and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-2-(4-piperidin-1-ylpiperidin-1-yl)ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-2-(4-piperidin-1-ylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 61215775 |
| Molecular Formula | C16H26BrN3S |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-2-(4-piperidin-1-ylpiperidin-1-yl)ethanamine |
| SMILES | NCC(c1ccc(Br)s1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C16H26BrN3S/c17-16-5-4-15(21-16)14(12-18)20-10-6-13(7-11-20)19-8-2-1-3-9-19/h4-5,13-14H,1-3,6-12,18H2 |
| InChIKey | SFKWABMXFPRUQD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |