C11H17BrN2OS — CID 103530959
2-(5-bromothiophen-2-yl)-2-(3-methoxypyrrolidin-1-yl)ethanamine (PubChem CID 103530959) has the molecular formula C11H17BrN2OS and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-2-(3-methoxypyrrolidin-1-yl)ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-2-(3-methoxypyrrolidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 103530959 |
| Molecular Formula | C11H17BrN2OS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-2-(3-methoxypyrrolidin-1-yl)ethanamine |
| SMILES | COC1CCN(C(CN)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C11H17BrN2OS/c1-15-8-4-5-14(7-8)9(6-13)10-2-3-11(12)16-10/h2-3,8-9H,4-7,13H2,1H3 |
| InChIKey | SPQZYVYBMCSCFO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |