C12H19BrN2O2 — CID 102965074
2-(5-bromofuran-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine (PubChem CID 102965074) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine.
| Compound Name | 2-(5-bromofuran-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 102965074 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine |
| SMILES | COC1CCCN(C(CN)c2ccc(Br)o2)C1 |
| InChI | InChI=1S/C12H19BrN2O2/c1-16-9-3-2-6-15(8-9)10(7-14)11-4-5-12(13)17-11/h4-5,9-10H,2-3,6-8,14H2,1H3 |
| InChIKey | RIGXVJCXZMYCSR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |