C16H23N3S — CID 79931950
2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)benzenecarbothioamide (PubChem CID 79931950) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)benzenecarbothioamide.
| Compound Name | 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 79931950 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1CN1CCN2CCCCC2C1 |
| InChI | InChI=1S/C16H23N3S/c17-16(20)15-7-2-1-5-13(15)11-18-9-10-19-8-4-3-6-14(19)12-18/h1-2,5,7,14H,3-4,6,8-12H2,(H2,17,20) |
| InChIKey | IQSDGQOMNMASND-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|