C15H19F2N3O — CID 79933931
(4-amino-3,5-difluorophenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone (PubChem CID 79933931) has the molecular formula C15H19F2N3O and a molecular weight of 295.33 g/mol. Its IUPAC name is (4-amino-3,5-difluorophenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (4-amino-3,5-difluorophenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 79933931 |
| Molecular Formula | C15H19F2N3O |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (4-amino-3,5-difluorophenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CC1CN2CCCC2CN1C(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C15H19F2N3O/c1-9-7-19-4-2-3-11(19)8-20(9)15(21)10-5-12(16)14(18)13(17)6-10/h5-6,9,11H,2-4,7-8,18H2,1H3 |
| InChIKey | ZTBNLPMLXWAPSG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|