C16H22FN3O — CID 103296644
(5-amino-2-fluoro-3-methylphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone (PubChem CID 103296644) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is (5-amino-2-fluoro-3-methylphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (5-amino-2-fluoro-3-methylphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 103296644 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (5-amino-2-fluoro-3-methylphenyl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
| SMILES | Cc1cc(N)cc(C(=O)N2CC3CCCN3CC2C)c1F |
| InChI | InChI=1S/C16H22FN3O/c1-10-6-12(18)7-14(15(10)17)16(21)20-9-13-4-3-5-19(13)8-11(20)2/h6-7,11,13H,3-5,8-9,18H2,1-2H3 |
| InChIKey | UJRAYLGCIWNCTK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|