C15H26N4S — CID 79934751
N-ethyl-5-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 79934751) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is N-ethyl-5-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-5-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79934751 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-ethyl-5-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(CN2CC3CCCCN3CC2C)s1 |
| InChI | InChI=1S/C15H26N4S/c1-3-16-15-17-8-14(20-15)11-19-10-13-6-4-5-7-18(13)9-12(19)2/h8,12-13H,3-7,9-11H2,1-2H3,(H,16,17) |
| InChIKey | JBDDFGODNYXIGP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |