C15H26N4 — CID 79934812
3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-cyclopropyl-2-(methylamino)propanenitrile (PubChem CID 79934812) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-cyclopropyl-2-(methylamino)propanenitrile.
| Compound Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-cyclopropyl-2-(methylamino)propanenitrile |
|---|---|
| PubChem CID | 79934812 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-cyclopropyl-2-(methylamino)propanenitrile |
| SMILES | CNC(C#N)(CN1CCN2CCCCC2C1)C1CC1 |
| InChI | InChI=1S/C15H26N4/c1-17-15(11-16,13-5-6-13)12-18-8-9-19-7-3-2-4-14(19)10-18/h13-14,17H,2-10,12H2,1H3 |
| InChIKey | PDOLBYFJGVLRQE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |