C14H23N5O — CID 79940586
(4-amino-1-ethylpyrazol-3-yl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone (PubChem CID 79940586) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is (4-amino-1-ethylpyrazol-3-yl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (4-amino-1-ethylpyrazol-3-yl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 79940586 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (4-amino-1-ethylpyrazol-3-yl)-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CCn1cc(N)c(C(=O)N2CC3CCCN3CC2C)n1 |
| InChI | InChI=1S/C14H23N5O/c1-3-18-9-12(15)13(16-18)14(20)19-8-11-5-4-6-17(11)7-10(19)2/h9-11H,3-8,15H2,1-2H3 |
| InChIKey | ATEZHJGUGAATPP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |