C14H27N3 — CID 79941280
[1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)cyclopentyl]methanamine (PubChem CID 79941280) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is [1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)cyclopentyl]methanamine.
| Compound Name | [1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 79941280 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | [1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)cyclopentyl]methanamine |
| SMILES | CC1CN2CCCC2CN1C1(CN)CCCC1 |
| InChI | InChI=1S/C14H27N3/c1-12-9-16-8-4-5-13(16)10-17(12)14(11-15)6-2-3-7-14/h12-13H,2-11,15H2,1H3 |
| InChIKey | BUNIRKGEKMBOOO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |