C14H19BrN2OS — CID 79942849
1-(5-bromothiophen-2-yl)-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethanone (PubChem CID 79942849) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethanone.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 79942849 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethanone |
| SMILES | CC1CN2CCCC2CN1CC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H19BrN2OS/c1-10-7-16-6-2-3-11(16)8-17(10)9-12(18)13-4-5-14(15)19-13/h4-5,10-11H,2-3,6-9H2,1H3 |
| InChIKey | OVACIWNNZDRDBD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |