C13H19BrN2O — CID 95792117
(3S,8aR)-2-[(5-bromofuran-2-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 95792117) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is (3S,8aR)-2-[(5-bromofuran-2-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (3S,8aR)-2-[(5-bromofuran-2-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 95792117 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (3S,8aR)-2-[(5-bromofuran-2-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C[C@H]1CN2CCC[C@@H]2CN1Cc1ccc(Br)o1 |
| InChI | InChI=1S/C13H19BrN2O/c1-10-7-15-6-2-3-11(15)8-16(10)9-12-4-5-13(14)17-12/h4-5,10-11H,2-3,6-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | KJAVUNFFXFBSSK-WDEREUQCSA-N |
| XLogP | 2.71 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |