C12H19N5O2S — CID 79943584
[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-4-pyridinyl]hydrazine (PubChem CID 79943584) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is [3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-4-pyridinyl]hydrazine.
| Compound Name | [3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-4-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79943584 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-4-pyridinyl]hydrazine |
| SMILES | NNc1ccncc1S(=O)(=O)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C12H19N5O2S/c13-15-11-3-4-14-8-12(11)20(18,19)17-7-6-16-5-1-2-10(16)9-17/h3-4,8,10H,1-2,5-7,9,13H2,(H,14,15) |
| InChIKey | BNGKOJSZVZXVOP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|