C15H19N3O2 — CID 79944693
2-(1-pyridin-2-ylethyl)-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione (PubChem CID 79944693) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(1-pyridin-2-ylethyl)-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione.
| Compound Name | 2-(1-pyridin-2-ylethyl)-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
|---|---|
| PubChem CID | 79944693 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(1-pyridin-2-ylethyl)-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
| SMILES | CC(c1ccccn1)N1CCC(=O)N2CCCC2C1=O |
| InChI | InChI=1S/C15H19N3O2/c1-11(12-5-2-3-8-16-12)17-10-7-14(19)18-9-4-6-13(18)15(17)20/h2-3,5,8,11,13H,4,6-7,9-10H2,1H3 |
| InChIKey | YKBMDNINVKCOSX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |