C21H24N4O2 — CID 19900982
1,6-bis(1-pyridin-2-ylethyl)-1,6-diazaspiro[4.4]nonane-2,7-dione (PubChem CID 19900982) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1,6-bis(1-pyridin-2-ylethyl)-1,6-diazaspiro[4.4]nonane-2,7-dione.
| Compound Name | 1,6-bis(1-pyridin-2-ylethyl)-1,6-diazaspiro[4.4]nonane-2,7-dione |
|---|---|
| PubChem CID | 19900982 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1,6-bis(1-pyridin-2-ylethyl)-1,6-diazaspiro[4.4]nonane-2,7-dione |
| SMILES | CC(c1ccccn1)N1C(=O)CCC12CCC(=O)N2C(C)c1ccccn1 |
| InChI | InChI=1S/C21H24N4O2/c1-15(17-7-3-5-13-22-17)24-19(26)9-11-21(24)12-10-20(27)25(21)16(2)18-8-4-6-14-23-18/h3-8,13-16H,9-12H2,1-2H3 |
| InChIKey | UBRHXGOBZZAIKY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |