C17H23NOS — CID 79946327
1-benzyl-7,7-dimethyl-9-thia-2-azaspiro[4.5]decan-3-one (PubChem CID 79946327) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-benzyl-7,7-dimethyl-9-thia-2-azaspiro[4.5]decan-3-one.
| Compound Name | 1-benzyl-7,7-dimethyl-9-thia-2-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 79946327 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-benzyl-7,7-dimethyl-9-thia-2-azaspiro[4.5]decan-3-one |
| SMILES | CC1(C)CSCC2(CC(=O)NC2Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H23NOS/c1-16(2)10-17(12-20-11-16)9-15(19)18-14(17)8-13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3,(H,18,19) |
| InChIKey | JIXWRGSEZPCSNB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |